C13H18 — CID 15627593
(E)-5,6-dimethylundec-5-en-1,9-diyne (PubChem CID 15627593) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is (E)-5,6-dimethylundec-5-en-1,9-diyne.
| Compound Name | (E)-5,6-dimethylundec-5-en-1,9-diyne |
|---|---|
| PubChem CID | 15627593 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (E)-5,6-dimethylundec-5-en-1,9-diyne |
| SMILES | C#CCC/C(C)=C(\C)CCC#CC |
| InChI | InChI=1S/C13H18/c1-5-7-9-11-13(4)12(3)10-8-6-2/h2H,8-11H2,1,3-4H3/b13-12+ |
| InChIKey | XVEQMZZDHVLEDM-OUKQBFOZSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|