C13H10N2PS+ — CID 100943719
3,5-diphenyl-1,3,4,2-thiadiazaphosphol-3-ium (PubChem CID 100943719) has the molecular formula C13H10N2PS+ and a molecular weight of 257.28 g/mol. Its IUPAC name is 3,5-diphenyl-1,3,4,2-thiadiazaphosphol-3-ium.
| Compound Name | 3,5-diphenyl-1,3,4,2-thiadiazaphosphol-3-ium |
|---|---|
| PubChem CID | 100943719 |
| Molecular Formula | C13H10N2PS+ |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 3,5-diphenyl-1,3,4,2-thiadiazaphosphol-3-ium |
| SMILES | c1ccc(-c2n[n+](-c3ccccc3)ps2)cc1 |
| InChI | InChI=1S/C13H10N2PS/c1-3-7-11(8-4-1)13-14-15(16-17-13)12-9-5-2-6-10-12/h1-10H/q+1 |
| InChIKey | LNOXLBFMRSESHK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |