C14H10N4S — CID 15557536
phenyl-(5-phenyl-1,3,4-thiadiazol-2-yl)diazene (PubChem CID 15557536) has the molecular formula C14H10N4S and a molecular weight of 266.33 g/mol. Its IUPAC name is phenyl-(5-phenyl-1,3,4-thiadiazol-2-yl)diazene.
| Compound Name | phenyl-(5-phenyl-1,3,4-thiadiazol-2-yl)diazene |
|---|---|
| PubChem CID | 15557536 |
| Molecular Formula | C14H10N4S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | phenyl-(5-phenyl-1,3,4-thiadiazol-2-yl)diazene |
| SMILES | c1ccc(/N=N/c2nnc(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C14H10N4S/c1-3-7-11(8-4-1)13-16-18-14(19-13)17-15-12-9-5-2-6-10-12/h1-10H/b17-15+ |
| InChIKey | SJRQLAODISXNGU-BMRADRMJSA-N |
| XLogP | 4.62 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|