C13H12N+ — CID 100944532
4-(3-methylphenyl)cyclohexa-2,4-dien-1-imine (PubChem CID 100944532) has the molecular formula C13H12N+ and a molecular weight of 182.25 g/mol. Its IUPAC name is 4-(3-methylphenyl)cyclohexa-2,4-dien-1-imine.
| Compound Name | 4-(3-methylphenyl)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 100944532 |
| Molecular Formula | C13H12N+ |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.10 |
| IUPAC Name | 4-(3-methylphenyl)cyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC(c2cccc(C)c2)=C[CH+]1 |
| InChI | InChI=1S/C13H12N/c1-10-3-2-4-12(9-10)11-5-7-13(14)8-6-11/h2-9,14H,1H3/q+1 |
| InChIKey | JQWRPRCJEOVTTA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|