C19H26O3 — CID 100946422
methyl (3S)-3-(2-methoxyphenyl)-2,2-dimethylnon-4-ynoate (PubChem CID 100946422) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is methyl (3S)-3-(2-methoxyphenyl)-2,2-dimethylnon-4-ynoate.
| Compound Name | methyl (3S)-3-(2-methoxyphenyl)-2,2-dimethylnon-4-ynoate |
|---|---|
| PubChem CID | 100946422 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | methyl (3S)-3-(2-methoxyphenyl)-2,2-dimethylnon-4-ynoate |
| SMILES | CCCCC#C[C@@H](c1ccccc1OC)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C19H26O3/c1-6-7-8-9-13-16(19(2,3)18(20)22-5)15-12-10-11-14-17(15)21-4/h10-12,14,16H,6-8H2,1-5H3/t16-/m0/s1 |
| InChIKey | MYXKYGKYCLJJMG-INIZCTEOSA-N |
| XLogP | 4.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|