C15H25N — CID 100947997
N-(2-cyclopenta-2,4-dien-1-ylpropan-2-yl)-N,4-dimethylpent-3-en-1-amine (PubChem CID 100947997) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-(2-cyclopenta-2,4-dien-1-ylpropan-2-yl)-N,4-dimethylpent-3-en-1-amine.
| Compound Name | N-(2-cyclopenta-2,4-dien-1-ylpropan-2-yl)-N,4-dimethylpent-3-en-1-amine |
|---|---|
| PubChem CID | 100947997 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-(2-cyclopenta-2,4-dien-1-ylpropan-2-yl)-N,4-dimethylpent-3-en-1-amine |
| SMILES | CC(C)=CCCN(C)C(C)(C)C1C=CC=C1 |
| InChI | InChI=1S/C15H25N/c1-13(2)9-8-12-16(5)15(3,4)14-10-6-7-11-14/h6-7,9-11,14H,8,12H2,1-5H3 |
| InChIKey | MEOCTPUDUHLBCF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|