About 2-tert-butyl-1,3,4,7-tetrahydrocyclopenta[c]pyridine
2-tert-butyl-1,3,4,7-tetrahydrocyclopenta[c]pyridine (PubChem CID 59576841) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 2-tert-butyl-1,3,4,7-tetrahydrocyclopenta[c]pyridine.
Analyze 2-tert-butyl-1,3,4,7-tetrahydrocyclopenta[c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1,3,4,7-tetrahydrocyclopenta[c]pyridine?
The IUPAC name of 2-tert-butyl-1,3,4,7-tetrahydrocyclopenta[c]pyridine (CID 59576841) is 2-tert-butyl-1,3,4,7-tetrahydrocyclopenta[c]pyridine.
What is the SMILES notation for 2-tert-butyl-1,3,4,7-tetrahydrocyclopenta[c]pyridine?
The canonical SMILES for 2-tert-butyl-1,3,4,7-tetrahydrocyclopenta[c]pyridine is CC(C)(C)N1CCC2=C(CC=C2)C1.
What is the InChIKey of 2-tert-butyl-1,3,4,7-tetrahydrocyclopenta[c]pyridine?
The InChIKey is CENISCCYLISLFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N/c1-12(2,3)13-8-7-10-5-4-6-11(10)9-13/h4-5H,6-9H2,1-3H3.
What are the key properties of 2-tert-butyl-1,3,4,7-tetrahydrocyclopenta[c]pyridine?
2-tert-butyl-1,3,4,7-tetrahydrocyclopenta[c]pyridine has a molecular weight of 177.29 g/mol, XLogP of 2.75, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1,3,4,7-tetrahydrocyclopenta[c]pyridine is sourced from PubChem (CID 59576841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).