C21H24N2O4S — CID 100949917
(2S,4S,5R)-4-methyl-2-[(5S)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]-3-(4-methylphenyl)sulfonyl-5-phenyl-1,3-oxazolidine (PubChem CID 100949917) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is (2S,4S,5R)-4-methyl-2-[(5S)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]-3-(4-methylphenyl)sulfonyl-5-phenyl-1,3-oxazolidine.
| Compound Name | (2S,4S,5R)-4-methyl-2-[(5S)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]-3-(4-methylphenyl)sulfonyl-5-phenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 100949917 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (2S,4S,5R)-4-methyl-2-[(5S)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]-3-(4-methylphenyl)sulfonyl-5-phenyl-1,3-oxazolidine |
| SMILES | CC1=NO[C@H]([C@@H]2O[C@H](c3ccccc3)[C@H](C)N2S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C21H24N2O4S/c1-14-9-11-18(12-10-14)28(24,25)23-16(3)20(17-7-5-4-6-8-17)26-21(23)19-13-15(2)22-27-19/h4-12,16,19-21H,13H2,1-3H3/t16-,19-,20-,21-/m0/s1 |
| InChIKey | TVJOFAUJRXAFNG-FIRPJDEBSA-N |
| XLogP | 3.64 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |