C18H21NO3S — CID 56931791
(2S,5S)-5-methyl-4-(4-methylphenyl)sulfonyl-2-phenylmorpholine (PubChem CID 56931791) has the molecular formula C18H21NO3S and a molecular weight of 331.40 g/mol. Its IUPAC name is (2S,5S)-5-methyl-4-(4-methylphenyl)sulfonyl-2-phenylmorpholine.
| Compound Name | (2S,5S)-5-methyl-4-(4-methylphenyl)sulfonyl-2-phenylmorpholine |
|---|---|
| PubChem CID | 56931791 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (2S,5S)-5-methyl-4-(4-methylphenyl)sulfonyl-2-phenylmorpholine |
| SMILES | C[C@H]1CO[C@H](CN1S(=O)(=O)C2=CC=C(C=C2)C)C3=CC=CC=C3 |
| InChI | InChI=1S/C18H21NO3S/c1-14-8-10-17(11-9-14)23(20,21)19-12-18(22-13-15(19)2)16-6-4-3-5-7-16/h3-11,15,18H,12-13H2,1-2H3/t15-,18+/m0/s1 |
| InChIKey | DQUYUEBNQGKJOS-MAUKXSAKSA-N |
| XLogP | 3.00 |
| TPSA | 55.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | 473 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |