C18H20BrNO3S — CID 134876041
2-(bromomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-5-phenyl-1,3-oxazolidine (PubChem CID 134876041) has the molecular formula C18H20BrNO3S and a molecular weight of 410.33 g/mol. Its IUPAC name is 2-(bromomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-5-phenyl-1,3-oxazolidine.
| Compound Name | 2-(bromomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-5-phenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 134876041 |
| Molecular Formula | C18H20BrNO3S |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 2-(bromomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-5-phenyl-1,3-oxazolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2C(CBr)OC(c3ccccc3)C2C)cc1 |
| InChI | InChI=1S/C18H20BrNO3S/c1-13-8-10-16(11-9-13)24(21,22)20-14(2)18(23-17(20)12-19)15-6-4-3-5-7-15/h3-11,14,17-18H,12H2,1-2H3 |
| InChIKey | QVKQDXUZGLRQFH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|