C26H30F3NO2 — CID 10095045
(2R)-1-[(1R,9R,13R)-13-butyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-3,3,3-trifluoro-2-methoxy-2-phenylpropan-1-one (PubChem CID 10095045) has the molecular formula C26H30F3NO2 and a molecular weight of 445.53 g/mol. Its IUPAC name is (2R)-1-[(1R,9R,13R)-13-butyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-3,3,3-trifluoro-2-methoxy-2-phenylpropan-1-one.
| Compound Name | (2R)-1-[(1R,9R,13R)-13-butyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-3,3,3-trifluoro-2-methoxy-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 10095045 |
| Molecular Formula | C26H30F3NO2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | (2R)-1-[(1R,9R,13R)-13-butyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-3,3,3-trifluoro-2-methoxy-2-phenylpropan-1-one |
| SMILES | CCCC[C@H]1[C@H]2Cc3ccccc3[C@@H]1CCN2C(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C26H30F3NO2/c1-3-4-13-22-21-15-16-30(23(22)17-18-10-8-9-14-20(18)21)24(31)25(32-2,26(27,28)29)19-11-6-5-7-12-19/h5-12,14,21-23H,3-4,13,15-17H2,1-2H3/t21-,22+,23+,25+/m0/s1 |
| InChIKey | MFQMEPNVBGJMJI-XJTUCQONSA-N |
| XLogP | 5.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |