C24H26F3NO2 — CID 51005198
(2R)-1-[(1S,9S,13S)-13-ethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-3,3,3-trifluoro-2-methoxy-2-phenylpropan-1-one (PubChem CID 51005198) has the molecular formula C24H26F3NO2 and a molecular weight of 417.47 g/mol. Its IUPAC name is (2R)-1-[(1S,9S,13S)-13-ethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-3,3,3-trifluoro-2-methoxy-2-phenylpropan-1-one.
| Compound Name | (2R)-1-[(1S,9S,13S)-13-ethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-3,3,3-trifluoro-2-methoxy-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 51005198 |
| Molecular Formula | C24H26F3NO2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (2R)-1-[(1S,9S,13S)-13-ethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-3,3,3-trifluoro-2-methoxy-2-phenylpropan-1-one |
| SMILES | CC[C@H]1[C@@H]2CCN(C(=O)[C@](OC)(c3ccccc3)C(F)(F)F)[C@H]1Cc1ccccc12 |
| InChI | InChI=1S/C24H26F3NO2/c1-3-18-20-13-14-28(21(18)15-16-9-7-8-12-19(16)20)22(29)23(30-2,24(25,26)27)17-10-5-4-6-11-17/h4-12,18,20-21H,3,13-15H2,1-2H3/t18-,20-,21-,23+/m0/s1 |
| InChIKey | DZKQGUQNLAELQF-XHRGMSINSA-N |
| XLogP | 5.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |