C17H27IN4O2 — CID 10095069
N-(1-ethyl-4-methyl-1,4-diazepan-6-yl)-5-iodo-2-methoxy-4-(methylamino)benzamide (PubChem CID 10095069) has the molecular formula C17H27IN4O2 and a molecular weight of 446.33 g/mol. Its IUPAC name is N-(1-ethyl-4-methyl-1,4-diazepan-6-yl)-5-iodo-2-methoxy-4-(methylamino)benzamide.
| Compound Name | N-(1-ethyl-4-methyl-1,4-diazepan-6-yl)-5-iodo-2-methoxy-4-(methylamino)benzamide |
|---|---|
| PubChem CID | 10095069 |
| Molecular Formula | C17H27IN4O2 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N-(1-ethyl-4-methyl-1,4-diazepan-6-yl)-5-iodo-2-methoxy-4-(methylamino)benzamide |
| SMILES | CCN1CCN(C)CC(NC(=O)c2cc(I)c(NC)cc2OC)C1 |
| InChI | InChI=1S/C17H27IN4O2/c1-5-22-7-6-21(3)10-12(11-22)20-17(23)13-8-14(18)15(19-2)9-16(13)24-4/h8-9,12,19H,5-7,10-11H2,1-4H3,(H,20,23) |
| InChIKey | MQVUZQWVCOYRLX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|