C24H31ClN4O3 — CID 10004356
4-acetamido-N-(1-benzyl-4-methyl-1,4-diazepan-6-yl)-5-chloro-2-ethoxybenzamide (PubChem CID 10004356) has the molecular formula C24H31ClN4O3 and a molecular weight of 458.99 g/mol. Its IUPAC name is 4-acetamido-N-(1-benzyl-4-methyl-1,4-diazepan-6-yl)-5-chloro-2-ethoxybenzamide.
| Compound Name | 4-acetamido-N-(1-benzyl-4-methyl-1,4-diazepan-6-yl)-5-chloro-2-ethoxybenzamide |
|---|---|
| PubChem CID | 10004356 |
| Molecular Formula | C24H31ClN4O3 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 4-acetamido-N-(1-benzyl-4-methyl-1,4-diazepan-6-yl)-5-chloro-2-ethoxybenzamide |
| SMILES | CCOc1cc(NC(C)=O)c(Cl)cc1C(=O)NC1CN(C)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H31ClN4O3/c1-4-32-23-13-22(26-17(2)30)21(25)12-20(23)24(31)27-19-15-28(3)10-11-29(16-19)14-18-8-6-5-7-9-18/h5-9,12-13,19H,4,10-11,14-16H2,1-3H3,(H,26,30)(H,27,31) |
| InChIKey | UUOCRBOSOHMGEW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |