C22H29ClN4O2 — CID 10093394
4-amino-N-[(1-benzyl-4-methylpiperazin-2-yl)methyl]-5-chloro-2-ethoxybenzamide (PubChem CID 10093394) has the molecular formula C22H29ClN4O2 and a molecular weight of 416.95 g/mol. Its IUPAC name is 4-amino-N-[(1-benzyl-4-methylpiperazin-2-yl)methyl]-5-chloro-2-ethoxybenzamide.
| Compound Name | 4-amino-N-[(1-benzyl-4-methylpiperazin-2-yl)methyl]-5-chloro-2-ethoxybenzamide |
|---|---|
| PubChem CID | 10093394 |
| Molecular Formula | C22H29ClN4O2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 4-amino-N-[(1-benzyl-4-methylpiperazin-2-yl)methyl]-5-chloro-2-ethoxybenzamide |
| SMILES | CCOc1cc(N)c(Cl)cc1C(=O)NCC1CN(C)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C22H29ClN4O2/c1-3-29-21-12-20(24)19(23)11-18(21)22(28)25-13-17-15-26(2)9-10-27(17)14-16-7-5-4-6-8-16/h4-8,11-12,17H,3,9-10,13-15,24H2,1-2H3,(H,25,28) |
| InChIKey | QRBVEFYDKWCBSV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|