C23H29Cl2N3O3 — CID 19848616
4-amino-5-chloro-N-[[4-[(2-chlorophenyl)methyl]-5,5-dimethylmorpholin-2-yl]methyl]-2-ethoxybenzamide (PubChem CID 19848616) has the molecular formula C23H29Cl2N3O3 and a molecular weight of 466.41 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[4-[(2-chlorophenyl)methyl]-5,5-dimethylmorpholin-2-yl]methyl]-2-ethoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[[4-[(2-chlorophenyl)methyl]-5,5-dimethylmorpholin-2-yl]methyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 19848616 |
| Molecular Formula | C23H29Cl2N3O3 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 4-amino-5-chloro-N-[[4-[(2-chlorophenyl)methyl]-5,5-dimethylmorpholin-2-yl]methyl]-2-ethoxybenzamide |
| SMILES | CCOc1cc(N)c(Cl)cc1C(=O)NCC1CN(Cc2ccccc2Cl)C(C)(C)CO1 |
| InChI | InChI=1S/C23H29Cl2N3O3/c1-4-30-21-10-20(26)19(25)9-17(21)22(29)27-11-16-13-28(23(2,3)14-31-16)12-15-7-5-6-8-18(15)24/h5-10,16H,4,11-14,26H2,1-3H3,(H,27,29) |
| InChIKey | OSHNLMXSVBNYPH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|