C17H27ClN4O2 — CID 10405900
4-amino-5-chloro-N-(1,4-dimethyl-1,4-diazepan-6-yl)-2-propoxybenzamide (PubChem CID 10405900) has the molecular formula C17H27ClN4O2 and a molecular weight of 354.88 g/mol. Its IUPAC name is 4-amino-5-chloro-N-(1,4-dimethyl-1,4-diazepan-6-yl)-2-propoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-(1,4-dimethyl-1,4-diazepan-6-yl)-2-propoxybenzamide |
|---|---|
| PubChem CID | 10405900 |
| Molecular Formula | C17H27ClN4O2 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 4-amino-5-chloro-N-(1,4-dimethyl-1,4-diazepan-6-yl)-2-propoxybenzamide |
| SMILES | CCCOc1cc(N)c(Cl)cc1C(=O)NC1CN(C)CCN(C)C1 |
| InChI | InChI=1S/C17H27ClN4O2/c1-4-7-24-16-9-15(19)14(18)8-13(16)17(23)20-12-10-21(2)5-6-22(3)11-12/h8-9,12H,4-7,10-11,19H2,1-3H3,(H,20,23) |
| InChIKey | HUEWKMCWSWGSEF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|