C23H26ClN3O2 — CID 15338141
4-amino-N-(1-benzylpyrrolidin-3-yl)-5-chloro-2-[(2S)-pent-3-yn-2-yl]oxybenzamide (PubChem CID 15338141) has the molecular formula C23H26ClN3O2 and a molecular weight of 411.93 g/mol. Its IUPAC name is 4-amino-N-(1-benzylpyrrolidin-3-yl)-5-chloro-2-[(2S)-pent-3-yn-2-yl]oxybenzamide.
| Compound Name | 4-amino-N-(1-benzylpyrrolidin-3-yl)-5-chloro-2-[(2S)-pent-3-yn-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 15338141 |
| Molecular Formula | C23H26ClN3O2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 4-amino-N-(1-benzylpyrrolidin-3-yl)-5-chloro-2-[(2S)-pent-3-yn-2-yl]oxybenzamide |
| SMILES | CC#C[C@H](C)Oc1cc(N)c(Cl)cc1C(=O)NC1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H26ClN3O2/c1-3-7-16(2)29-22-13-21(25)20(24)12-19(22)23(28)26-18-10-11-27(15-18)14-17-8-5-4-6-9-17/h4-6,8-9,12-13,16,18H,10-11,14-15,25H2,1-2H3,(H,26,28)/t16-,18?/m0/s1 |
| InChIKey | YVBVJABOQVJFCP-ATNAJCNCSA-N |
| XLogP | 3.72 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|