C20H27Cl2N3O2 — CID 69232820
4-amino-5-chloro-N-[(2R)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-2-[(2S)-pent-3-yn-2-yl]oxybenzamide;hydrochloride (PubChem CID 69232820) has the molecular formula C20H27Cl2N3O2 and a molecular weight of 412.36 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[(2R)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-2-[(2S)-pent-3-yn-2-yl]oxybenzamide;hydrochloride.
| Compound Name | 4-amino-5-chloro-N-[(2R)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-2-[(2S)-pent-3-yn-2-yl]oxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 69232820 |
| Molecular Formula | C20H27Cl2N3O2 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-amino-5-chloro-N-[(2R)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-2-[(2S)-pent-3-yn-2-yl]oxybenzamide;hydrochloride |
| SMILES | CC#C[C@H](C)Oc1cc(N)c(Cl)cc1C(=O)N[C@@H]1CCC2CCC1N2C.Cl |
| InChI | InChI=1S/C20H26ClN3O2.ClH/c1-4-5-12(2)26-19-11-16(22)15(21)10-14(19)20(25)23-17-8-6-13-7-9-18(17)24(13)3;/h10-13,17-18H,6-9,22H2,1-3H3,(H,23,25);1H/t12-,13?,17+,18?;/m0./s1 |
| InChIKey | YGUDRHMPCMVVGA-QLAYZTAZSA-N |
| XLogP | 3.49 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|