C22H31Cl2N3O2 — CID 19048273
4-amino-5-chloro-2-hept-4-yn-2-yloxy-N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)benzamide;hydrochloride (PubChem CID 19048273) has the molecular formula C22H31Cl2N3O2 and a molecular weight of 440.42 g/mol. Its IUPAC name is 4-amino-5-chloro-2-hept-4-yn-2-yloxy-N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)benzamide;hydrochloride.
| Compound Name | 4-amino-5-chloro-2-hept-4-yn-2-yloxy-N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 19048273 |
| Molecular Formula | C22H31Cl2N3O2 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 4-amino-5-chloro-2-hept-4-yn-2-yloxy-N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)benzamide;hydrochloride |
| SMILES | CCC#CCC(C)Oc1cc(N)c(Cl)cc1C(=O)NC1CC2CCC(C1)N2C.Cl |
| InChI | InChI=1S/C22H30ClN3O2.ClH/c1-4-5-6-7-14(2)28-21-13-20(24)19(23)12-18(21)22(27)25-15-10-16-8-9-17(11-15)26(16)3;/h12-17H,4,7-11,24H2,1-3H3,(H,25,27);1H |
| InChIKey | XTOGLLPUHDYJJH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|