C21H26ClN3O2 — CID 163773200
4-amino-5-chloro-N-(5-methyl-5-azatricyclo[4.3.0.01,4]nonan-8-yl)-2-pent-4-yn-2-yloxybenzamide (PubChem CID 163773200) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is 4-amino-5-chloro-N-(5-methyl-5-azatricyclo[4.3.0.01,4]nonan-8-yl)-2-pent-4-yn-2-yloxybenzamide.
| Compound Name | 4-amino-5-chloro-N-(5-methyl-5-azatricyclo[4.3.0.01,4]nonan-8-yl)-2-pent-4-yn-2-yloxybenzamide |
|---|---|
| PubChem CID | 163773200 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 4-amino-5-chloro-N-(5-methyl-5-azatricyclo[4.3.0.01,4]nonan-8-yl)-2-pent-4-yn-2-yloxybenzamide |
| SMILES | C#CCC(C)Oc1cc(N)c(Cl)cc1C(=O)NC1CC2N(C)C3CCC32C1 |
| InChI | InChI=1S/C21H26ClN3O2/c1-4-5-12(2)27-17-10-16(23)15(22)9-14(17)20(26)24-13-8-19-21(11-13)7-6-18(21)25(19)3/h1,9-10,12-13,18-19H,5-8,11,23H2,2-3H3,(H,24,26) |
| InChIKey | MIEIABFUJGTQBL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|