C21H29Cl2N3O3 — CID 69230758
4-amino-5-chloro-N-[(6R)-6-methoxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-2-[(2S)-pent-3-yn-2-yl]oxybenzamide;hydrochloride (PubChem CID 69230758) has the molecular formula C21H29Cl2N3O3 and a molecular weight of 442.39 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[(6R)-6-methoxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-2-[(2S)-pent-3-yn-2-yl]oxybenzamide;hydrochloride.
| Compound Name | 4-amino-5-chloro-N-[(6R)-6-methoxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-2-[(2S)-pent-3-yn-2-yl]oxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 69230758 |
| Molecular Formula | C21H29Cl2N3O3 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 4-amino-5-chloro-N-[(6R)-6-methoxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-2-[(2S)-pent-3-yn-2-yl]oxybenzamide;hydrochloride |
| SMILES | CC#C[C@H](C)Oc1cc(N)c(Cl)cc1C(=O)NC1CC2C[C@@H](OC)C(C1)N2C.Cl |
| InChI | InChI=1S/C21H28ClN3O3.ClH/c1-5-6-12(2)28-19-11-17(23)16(22)10-15(19)21(26)24-13-7-14-9-20(27-4)18(8-13)25(14)3;/h10-14,18,20H,7-9,23H2,1-4H3,(H,24,26);1H/t12-,13?,14?,18?,20+;/m0./s1 |
| InChIKey | GUGIOPMPCCNYFQ-LFPRUXFYSA-N |
| XLogP | 3.11 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|