C22H30ClN3O2 — CID 19694210
4-amino-5-chloro-2-pent-3-yn-2-yloxy-N-(3-propan-2-yl-3-azabicyclo[3.2.1]octan-8-yl)benzamide (PubChem CID 19694210) has the molecular formula C22H30ClN3O2 and a molecular weight of 403.95 g/mol. Its IUPAC name is 4-amino-5-chloro-2-pent-3-yn-2-yloxy-N-(3-propan-2-yl-3-azabicyclo[3.2.1]octan-8-yl)benzamide.
| Compound Name | 4-amino-5-chloro-2-pent-3-yn-2-yloxy-N-(3-propan-2-yl-3-azabicyclo[3.2.1]octan-8-yl)benzamide |
|---|---|
| PubChem CID | 19694210 |
| Molecular Formula | C22H30ClN3O2 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 4-amino-5-chloro-2-pent-3-yn-2-yloxy-N-(3-propan-2-yl-3-azabicyclo[3.2.1]octan-8-yl)benzamide |
| SMILES | CC#CC(C)Oc1cc(N)c(Cl)cc1C(=O)NC1C2CCC1CN(C(C)C)C2 |
| InChI | InChI=1S/C22H30ClN3O2/c1-5-6-14(4)28-20-10-19(24)18(23)9-17(20)22(27)25-21-15-7-8-16(21)12-26(11-15)13(2)3/h9-10,13-16,21H,7-8,11-12,24H2,1-4H3,(H,25,27) |
| InChIKey | IPXQAWSREZHVIX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|