C16H22ClN3O2 — CID 19766291
4-amino-5-chloro-2-methoxy-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)benzamide (PubChem CID 19766291) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)benzamide |
|---|---|
| PubChem CID | 19766291 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1C2CCN(CC2)C1C |
| InChI | InChI=1S/C16H22ClN3O2/c1-9-15(10-3-5-20(9)6-4-10)19-16(21)11-7-12(17)13(18)8-14(11)22-2/h7-10,15H,3-6,18H2,1-2H3,(H,19,21) |
| InChIKey | JLUMIIXDSABYLH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|