C22H35ClN4O2 — CID 19108393
4-amino-N-[2-(4-aminoheptan-4-yl)-1-azabicyclo[2.2.2]octan-3-yl]-5-chloro-2-methoxybenzamide (PubChem CID 19108393) has the molecular formula C22H35ClN4O2 and a molecular weight of 423.00 g/mol. Its IUPAC name is 4-amino-N-[2-(4-aminoheptan-4-yl)-1-azabicyclo[2.2.2]octan-3-yl]-5-chloro-2-methoxybenzamide.
| Compound Name | 4-amino-N-[2-(4-aminoheptan-4-yl)-1-azabicyclo[2.2.2]octan-3-yl]-5-chloro-2-methoxybenzamide |
|---|---|
| PubChem CID | 19108393 |
| Molecular Formula | C22H35ClN4O2 |
| Molecular Weight | 423.00 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 4-amino-N-[2-(4-aminoheptan-4-yl)-1-azabicyclo[2.2.2]octan-3-yl]-5-chloro-2-methoxybenzamide |
| SMILES | CCCC(N)(CCC)C1C(NC(=O)c2cc(Cl)c(N)cc2OC)C2CCN1CC2 |
| InChI | InChI=1S/C22H35ClN4O2/c1-4-8-22(25,9-5-2)20-19(14-6-10-27(20)11-7-14)26-21(28)15-12-16(23)17(24)13-18(15)29-3/h12-14,19-20H,4-11,24-25H2,1-3H3,(H,26,28) |
| InChIKey | UEIKAQPZPWXZGB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.00 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|