C20H26ClN3O6 — CID 162316926
4-amino-5-chloro-2-methoxy-N-[(2R)-2-methyl-1-azabicyclo[2.2.2]octan-3-yl]benzamide;(E)-but-2-enedioic acid (PubChem CID 162316926) has the molecular formula C20H26ClN3O6 and a molecular weight of 439.90 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[(2R)-2-methyl-1-azabicyclo[2.2.2]octan-3-yl]benzamide;(E)-but-2-enedioic acid.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[(2R)-2-methyl-1-azabicyclo[2.2.2]octan-3-yl]benzamide;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 162316926 |
| Molecular Formula | C20H26ClN3O6 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[(2R)-2-methyl-1-azabicyclo[2.2.2]octan-3-yl]benzamide;(E)-but-2-enedioic acid |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1C2CCN(CC2)[C@@H]1C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H22ClN3O2.C4H4O4/c1-9-15(10-3-5-20(9)6-4-10)19-16(21)11-7-12(17)13(18)8-14(11)22-2;5-3(6)1-2-4(7)8/h7-10,15H,3-6,18H2,1-2H3,(H,19,21);1-2H,(H,5,6)(H,7,8)/b;2-1+/t9-,15?;/m1./s1 |
| InChIKey | QBEHVRCXJGTRFX-DFVNUSLUSA-N |
| XLogP | 1.86 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|