C19H28ClN3O4 — CID 67283222
tert-butyl 2-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-4-methylpiperidine-1-carboxylate (PubChem CID 67283222) has the molecular formula C19H28ClN3O4 and a molecular weight of 397.90 g/mol. Its IUPAC name is tert-butyl 2-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 67283222 |
| Molecular Formula | C19H28ClN3O4 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | tert-butyl 2-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-4-methylpiperidine-1-carboxylate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1CC(C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28ClN3O4/c1-11-6-7-23(18(25)27-19(2,3)4)16(8-11)22-17(24)12-9-13(20)14(21)10-15(12)26-5/h9-11,16H,6-8,21H2,1-5H3,(H,22,24) |
| InChIKey | WFBYLHIJYPUSCG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|