C21H35Cl2N3O3 — CID 19108540
4-amino-5-chloro-2-methoxy-N-[2-[(4-methylpiperidin-1-yl)methyl]cyclohexyl]benzamide;hydrate;hydrochloride (PubChem CID 19108540) has the molecular formula C21H35Cl2N3O3 and a molecular weight of 448.44 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[2-[(4-methylpiperidin-1-yl)methyl]cyclohexyl]benzamide;hydrate;hydrochloride.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[2-[(4-methylpiperidin-1-yl)methyl]cyclohexyl]benzamide;hydrate;hydrochloride |
|---|---|
| PubChem CID | 19108540 |
| Molecular Formula | C21H35Cl2N3O3 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[2-[(4-methylpiperidin-1-yl)methyl]cyclohexyl]benzamide;hydrate;hydrochloride |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1CCCCC1CN1CCC(C)CC1.Cl.O |
| InChI | InChI=1S/C21H32ClN3O2.ClH.H2O/c1-14-7-9-25(10-8-14)13-15-5-3-4-6-19(15)24-21(26)16-11-17(22)18(23)12-20(16)27-2;;/h11-12,14-15,19H,3-10,13,23H2,1-2H3,(H,24,26);1H;1H2 |
| InChIKey | XBVZBJZSGKRAOK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|