C25H25N5O3 — CID 100954106
3-morpholin-4-yl-2-nitro-1-N,1-N'-diphenyl-3-phenyliminoprop-1-ene-1,1-diamine (PubChem CID 100954106) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is 3-morpholin-4-yl-2-nitro-1-N,1-N'-diphenyl-3-phenyliminoprop-1-ene-1,1-diamine.
| Compound Name | 3-morpholin-4-yl-2-nitro-1-N,1-N'-diphenyl-3-phenyliminoprop-1-ene-1,1-diamine |
|---|---|
| PubChem CID | 100954106 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 3-morpholin-4-yl-2-nitro-1-N,1-N'-diphenyl-3-phenyliminoprop-1-ene-1,1-diamine |
| SMILES | O=[N+]([O-])C(=C(Nc1ccccc1)Nc1ccccc1)/C(=N/c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C25H25N5O3/c31-30(32)23(25(29-16-18-33-19-17-29)28-22-14-8-3-9-15-22)24(26-20-10-4-1-5-11-20)27-21-12-6-2-7-13-21/h1-15,26-27H,16-19H2/b28-25- |
| InChIKey | BFDVXUXHOGZSAB-FVDSYPCUSA-N |
| XLogP | 4.72 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|