C16H22N2O3S — CID 100956159
[(1-hydroxy-2-oxocycloheptyl)-(4-methoxyphenyl)methyl] carbamimidothioate (PubChem CID 100956159) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is [(1-hydroxy-2-oxocycloheptyl)-(4-methoxyphenyl)methyl] carbamimidothioate.
| Compound Name | [(1-hydroxy-2-oxocycloheptyl)-(4-methoxyphenyl)methyl] carbamimidothioate |
|---|---|
| PubChem CID | 100956159 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [(1-hydroxy-2-oxocycloheptyl)-(4-methoxyphenyl)methyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SC(c1ccc(OC)cc1)C1(O)CCCCCC1=O |
| InChI | InChI=1S/C16H22N2O3S/c1-21-12-8-6-11(7-9-12)14(22-15(17)18)16(20)10-4-2-3-5-13(16)19/h6-9,14,20H,2-5,10H2,1H3,(H3,17,18) |
| InChIKey | DDZNVCADBXAKBE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 96.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|