About (3-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undecan-4-yl) 3-chlorobenzoate
(3-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undecan-4-yl) 3-chlorobenzoate (PubChem CID 100957858) has the molecular formula C17H21ClO5
and a molecular weight of 340.80 g/mol. Its IUPAC name is (3-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undecan-4-yl) 3-chlorobenzoate.
Molecular Properties
| Compound Name | (3-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undecan-4-yl) 3-chlorobenzoate |
| PubChem CID | 100957858 |
| Molecular Formula | C17H21ClO5 |
| Molecular Weight | 340.80 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (3-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undecan-4-yl) 3-chlorobenzoate |
| SMILES | CC1(O)COC2(CCCCC2)OC1OC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H21ClO5/c1-16(20)11-21-17(8-3-2-4-9-17)23-15(16)22-14(19)12-6-5-7-13(18)10-12/h5-7,10,15,20H,2-4,8-9,11H2,1H3 |
| InChIKey | JFJFZKFOZPKPCA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.80 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undecan-4-yl) 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undecan-4-yl) 3-chlorobenzoate?
The IUPAC name of (3-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undecan-4-yl) 3-chlorobenzoate (CID 100957858) is (3-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undecan-4-yl) 3-chlorobenzoate.
What is the SMILES notation for (3-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undecan-4-yl) 3-chlorobenzoate?
The canonical SMILES for (3-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undecan-4-yl) 3-chlorobenzoate is CC1(O)COC2(CCCCC2)OC1OC(=O)c1cccc(Cl)c1.
What is the InChIKey of (3-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undecan-4-yl) 3-chlorobenzoate?
The InChIKey is JFJFZKFOZPKPCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClO5/c1-16(20)11-21-17(8-3-2-4-9-17)23-15(16)22-14(19)12-6-5-7-13(18)10-12/h5-7,10,15,20H,2-4,8-9,11H2,1H3.
What are the key properties of (3-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undecan-4-yl) 3-chlorobenzoate?
(3-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undecan-4-yl) 3-chlorobenzoate has a molecular weight of 340.80 g/mol, XLogP of 3.28, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undecan-4-yl) 3-chlorobenzoate is sourced from PubChem (CID 100957858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).