C25H33ClO6 — CID 10961608
[(1S,2S,6R,7R,8S,11S,15R)-8-hydroxy-4,4,7,14,14,15-hexamethyl-3,5,10-trioxatetracyclo[6.6.1.02,6.011,15]pentadecan-9-yl] 3-chlorobenzoate (PubChem CID 10961608) has the molecular formula C25H33ClO6 and a molecular weight of 464.99 g/mol. Its IUPAC name is [(1S,2S,6R,7R,8S,11S,15R)-8-hydroxy-4,4,7,14,14,15-hexamethyl-3,5,10-trioxatetracyclo[6.6.1.02,6.011,15]pentadecan-9-yl] 3-chlorobenzoate.
| Compound Name | [(1S,2S,6R,7R,8S,11S,15R)-8-hydroxy-4,4,7,14,14,15-hexamethyl-3,5,10-trioxatetracyclo[6.6.1.02,6.011,15]pentadecan-9-yl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 10961608 |
| Molecular Formula | C25H33ClO6 |
| Molecular Weight | 464.99 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | [(1S,2S,6R,7R,8S,11S,15R)-8-hydroxy-4,4,7,14,14,15-hexamethyl-3,5,10-trioxatetracyclo[6.6.1.02,6.011,15]pentadecan-9-yl] 3-chlorobenzoate |
| SMILES | C[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@H]2C(C)(C)CC[C@@H]3OC(OC(=O)c4cccc(Cl)c4)[C@@]1(O)[C@@]32C |
| InChI | InChI=1S/C25H33ClO6/c1-13-17-18(32-23(4,5)31-17)19-22(2,3)11-10-16-24(19,6)25(13,28)21(29-16)30-20(27)14-8-7-9-15(26)12-14/h7-9,12-13,16-19,21,28H,10-11H2,1-6H3/t13-,16+,17-,18-,19+,21?,24+,25-/m1/s1 |
| InChIKey | QLISPWXISSQDNE-URPMQPPHSA-N |
| XLogP | 4.57 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.99 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |