C23H48O5Si2 — CID 10095810
2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R,3S,6R)-3-methyl-6-[(2S)-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxan-2-yl]ethanone (PubChem CID 10095810) has the molecular formula C23H48O5Si2 and a molecular weight of 460.80 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R,3S,6R)-3-methyl-6-[(2S)-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxan-2-yl]ethanone.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R,3S,6R)-3-methyl-6-[(2S)-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxan-2-yl]ethanone |
|---|---|
| PubChem CID | 10095810 |
| Molecular Formula | C23H48O5Si2 |
| Molecular Weight | 460.80 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R,3S,6R)-3-methyl-6-[(2S)-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxan-2-yl]ethanone |
| SMILES | C[C@@H](COCOCC[Si](C)(C)C)[C@H]1CC[C@H](C)[C@H](C(=O)CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H48O5Si2/c1-18-11-12-21(19(2)15-26-17-25-13-14-29(6,7)8)28-22(18)20(24)16-27-30(9,10)23(3,4)5/h18-19,21-22H,11-17H2,1-10H3/t18-,19-,21+,22+/m0/s1 |
| InChIKey | FBYNTNLMYQYASK-SEIRJHJZSA-N |
| XLogP | 5.73 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.80 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|