C23H48O7Si — CID 10671839
(2S,5R,6R,7R,8R)-10-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-6,8-bis(methoxymethoxy)-5,7-dimethyldecanal (PubChem CID 10671839) has the molecular formula C23H48O7Si and a molecular weight of 464.72 g/mol. Its IUPAC name is (2S,5R,6R,7R,8R)-10-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-6,8-bis(methoxymethoxy)-5,7-dimethyldecanal.
| Compound Name | (2S,5R,6R,7R,8R)-10-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-6,8-bis(methoxymethoxy)-5,7-dimethyldecanal |
|---|---|
| PubChem CID | 10671839 |
| Molecular Formula | C23H48O7Si |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.32 |
| IUPAC Name | (2S,5R,6R,7R,8R)-10-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-6,8-bis(methoxymethoxy)-5,7-dimethyldecanal |
| SMILES | COCO[C@@H]([C@H](C)[C@@H](CCO[Si](C)(C)C(C)(C)C)OCOC)[C@H](C)CC[C@@H](C=O)OC |
| InChI | InChI=1S/C23H48O7Si/c1-18(11-12-20(15-24)27-8)22(29-17-26-7)19(2)21(28-16-25-6)13-14-30-31(9,10)23(3,4)5/h15,18-22H,11-14,16-17H2,1-10H3/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | SRJDMNNLVNOMAL-QMCAAQAGSA-N |
| XLogP | 4.64 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|