C11H17NO6 — CID 100959228
ethyl (3aR,4S,5R,7R,7aS)-7-carbamoyl-4-hydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylate (PubChem CID 100959228) has the molecular formula C11H17NO6 and a molecular weight of 259.26 g/mol. Its IUPAC name is ethyl (3aR,4S,5R,7R,7aS)-7-carbamoyl-4-hydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylate.
| Compound Name | ethyl (3aR,4S,5R,7R,7aS)-7-carbamoyl-4-hydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 100959228 |
| Molecular Formula | C11H17NO6 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | ethyl (3aR,4S,5R,7R,7aS)-7-carbamoyl-4-hydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H](C(N)=O)[C@@H]2OCO[C@@H]2[C@H]1O |
| InChI | InChI=1S/C11H17NO6/c1-2-16-11(15)5-3-6(10(12)14)8-9(7(5)13)18-4-17-8/h5-9,13H,2-4H2,1H3,(H2,12,14)/t5-,6-,7+,8+,9-/m1/s1 |
| InChIKey | IDXOHIFXZGRQEQ-XGQMLPDNSA-N |
| XLogP | -1.23 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |