C11H14O8 — CID 15450237
(3aS,4R,6R,7S,7aR)-6-ethoxycarbonyl-7-hydroxy-2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4-carboxylic acid (PubChem CID 15450237) has the molecular formula C11H14O8 and a molecular weight of 274.23 g/mol. Its IUPAC name is (3aS,4R,6R,7S,7aR)-6-ethoxycarbonyl-7-hydroxy-2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4-carboxylic acid.
| Compound Name | (3aS,4R,6R,7S,7aR)-6-ethoxycarbonyl-7-hydroxy-2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4-carboxylic acid |
|---|---|
| PubChem CID | 15450237 |
| Molecular Formula | C11H14O8 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | (3aS,4R,6R,7S,7aR)-6-ethoxycarbonyl-7-hydroxy-2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4-carboxylic acid |
| SMILES | CCOC(=O)[C@@H]1C[C@@H](C(=O)O)[C@@H]2OC(=O)O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C11H14O8/c1-2-17-10(15)4-3-5(9(13)14)7-8(6(4)12)19-11(16)18-7/h4-8,12H,2-3H2,1H3,(H,13,14)/t4-,5-,6+,7+,8-/m1/s1 |
| InChIKey | KHTCAQSPIJPYAL-QQGCVABSSA-N |
| XLogP | -0.46 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |