C12H24O2Si — CID 100960144
[(1E,3E)-1-ethoxy-2-(methoxymethyl)penta-1,3-dien-3-yl]-trimethylsilane (PubChem CID 100960144) has the molecular formula C12H24O2Si and a molecular weight of 228.41 g/mol. Its IUPAC name is [(1E,3E)-1-ethoxy-2-(methoxymethyl)penta-1,3-dien-3-yl]-trimethylsilane.
| Compound Name | [(1E,3E)-1-ethoxy-2-(methoxymethyl)penta-1,3-dien-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 100960144 |
| Molecular Formula | C12H24O2Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | [(1E,3E)-1-ethoxy-2-(methoxymethyl)penta-1,3-dien-3-yl]-trimethylsilane |
| SMILES | C/C=C(C(=C\OCC)\COC)/[Si](C)(C)C |
| InChI | InChI=1S/C12H24O2Si/c1-7-12(15(4,5)6)11(9-13-3)10-14-8-2/h7,10H,8-9H2,1-6H3/b11-10+,12-7+ |
| InChIKey | JTAIEUWSTWFRPY-MLKCCRLUSA-N |
| XLogP | 3.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|