C13H26O2Si — CID 11470546
triethyl-[(1E,3Z)-1-methoxy-2-methylpenta-1,3-dien-3-yl]oxysilane (PubChem CID 11470546) has the molecular formula C13H26O2Si and a molecular weight of 242.44 g/mol. Its IUPAC name is triethyl-[(1E,3Z)-1-methoxy-2-methylpenta-1,3-dien-3-yl]oxysilane.
| Compound Name | triethyl-[(1E,3Z)-1-methoxy-2-methylpenta-1,3-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 11470546 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.44 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | triethyl-[(1E,3Z)-1-methoxy-2-methylpenta-1,3-dien-3-yl]oxysilane |
| SMILES | C/C=C(O[Si](CC)(CC)CC)/C(C)=C/OC |
| InChI | InChI=1S/C13H26O2Si/c1-7-13(12(5)11-14-6)15-16(8-2,9-3)10-4/h7,11H,8-10H2,1-6H3/b12-11+,13-7- |
| InChIKey | ATGFZGCXAAHJIL-UYTHXWSBSA-N |
| XLogP | 4.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|