C13H26O2Si — CID 11322468
trimethyl-[(1E,3Z)-2-methyl-1-[(2-methylpropan-2-yl)oxy]penta-1,3-dien-3-yl]oxysilane (PubChem CID 11322468) has the molecular formula C13H26O2Si and a molecular weight of 242.43 g/mol. Its IUPAC name is trimethyl-[(1E,3Z)-2-methyl-1-[(2-methylpropan-2-yl)oxy]penta-1,3-dien-3-yl]oxysilane.
| Compound Name | trimethyl-[(1E,3Z)-2-methyl-1-[(2-methylpropan-2-yl)oxy]penta-1,3-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 11322468 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | trimethyl-[(1E,3Z)-2-methyl-1-[(2-methylpropan-2-yl)oxy]penta-1,3-dien-3-yl]oxysilane |
| SMILES | C/C=C(O[Si](C)(C)C)/C(C)=C/OC(C)(C)C |
| InChI | InChI=1S/C13H26O2Si/c1-9-12(15-16(6,7)8)11(2)10-14-13(3,4)5/h9-10H,1-8H3/b11-10+,12-9- |
| InChIKey | GHDGFRTUYUPEGR-MWOVLNQWSA-N |
| XLogP | 4.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|