C9H18O2Si — CID 54308306
(4-methoxy-3-methylbuta-1,3-dien-2-yl)oxy-trimethylsilane (PubChem CID 54308306) has the molecular formula C9H18O2Si and a molecular weight of 186.33 g/mol. Its IUPAC name is (4-methoxy-3-methylbuta-1,3-dien-2-yl)oxy-trimethylsilane.
| Compound Name | (4-methoxy-3-methylbuta-1,3-dien-2-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 54308306 |
| Molecular Formula | C9H18O2Si |
| Molecular Weight | 186.33 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (4-methoxy-3-methylbuta-1,3-dien-2-yl)oxy-trimethylsilane |
| SMILES | C=C(O[Si](C)(C)C)C(C)=COC |
| InChI | InChI=1S/C9H18O2Si/c1-8(7-10-3)9(2)11-12(4,5)6/h7H,2H2,1,3-6H3 |
| InChIKey | SJCCHURCDFWFLG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|