C13H26O3Si2 — CID 10891478
[3-(methoxymethylidene)-4-trimethylsilyloxypenta-1,4-dien-2-yl]oxy-trimethylsilane (PubChem CID 10891478) has the molecular formula C13H26O3Si2 and a molecular weight of 286.52 g/mol. Its IUPAC name is [3-(methoxymethylidene)-4-trimethylsilyloxypenta-1,4-dien-2-yl]oxy-trimethylsilane.
| Compound Name | [3-(methoxymethylidene)-4-trimethylsilyloxypenta-1,4-dien-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10891478 |
| Molecular Formula | C13H26O3Si2 |
| Molecular Weight | 286.52 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | [3-(methoxymethylidene)-4-trimethylsilyloxypenta-1,4-dien-2-yl]oxy-trimethylsilane |
| SMILES | C=C(O[Si](C)(C)C)C(=COC)C(=C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H26O3Si2/c1-11(15-17(4,5)6)13(10-14-3)12(2)16-18(7,8)9/h10H,1-2H2,3-9H3 |
| InChIKey | HRBKAKLHEDSRIG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|