C13H24O2Si — CID 71507796
tert-butyl-[(3E)-3-(methoxymethylidene)penta-1,4-dien-2-yl]oxy-dimethylsilane (PubChem CID 71507796) has the molecular formula C13H24O2Si and a molecular weight of 240.42 g/mol. Its IUPAC name is tert-butyl-[(3E)-3-(methoxymethylidene)penta-1,4-dien-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3E)-3-(methoxymethylidene)penta-1,4-dien-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 71507796 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | tert-butyl-[(3E)-3-(methoxymethylidene)penta-1,4-dien-2-yl]oxy-dimethylsilane |
| SMILES | C=C/C(=C\OC)C(=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H24O2Si/c1-9-12(10-14-6)11(2)15-16(7,8)13(3,4)5/h9-10H,1-2H2,3-8H3/b12-10+ |
| InChIKey | SXPOZORQKFGXTF-ZRDIBKRKSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|