C17H36O2Si2 — CID 11809625
tert-butyl-dimethyl-[(1E,3Z)-2-methyl-1-(2-trimethylsilylethoxy)penta-1,3-dien-3-yl]oxysilane (PubChem CID 11809625) has the molecular formula C17H36O2Si2 and a molecular weight of 328.65 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1E,3Z)-2-methyl-1-(2-trimethylsilylethoxy)penta-1,3-dien-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1E,3Z)-2-methyl-1-(2-trimethylsilylethoxy)penta-1,3-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 11809625 |
| Molecular Formula | C17H36O2Si2 |
| Molecular Weight | 328.65 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | tert-butyl-dimethyl-[(1E,3Z)-2-methyl-1-(2-trimethylsilylethoxy)penta-1,3-dien-3-yl]oxysilane |
| SMILES | C/C=C(O[Si](C)(C)C(C)(C)C)/C(C)=C/OCC[Si](C)(C)C |
| InChI | InChI=1S/C17H36O2Si2/c1-11-16(19-21(9,10)17(3,4)5)15(2)14-18-12-13-20(6,7)8/h11,14H,12-13H2,1-10H3/b15-14+,16-11- |
| InChIKey | ICQQGJJDSCHYNZ-IWULDBEZSA-N |
| XLogP | 6.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.65 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|