C27H50O3Si2 — CID 134979327
tert-butyl-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[(1E,3E,5E,7E,9E)-dodeca-1,3,5,7,9-pentaenoxy]propan-2-yl]oxy-dimethylsilane (PubChem CID 134979327) has the molecular formula C27H50O3Si2 and a molecular weight of 478.87 g/mol. Its IUPAC name is tert-butyl-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[(1E,3E,5E,7E,9E)-dodeca-1,3,5,7,9-pentaenoxy]propan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[(1E,3E,5E,7E,9E)-dodeca-1,3,5,7,9-pentaenoxy]propan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134979327 |
| Molecular Formula | C27H50O3Si2 |
| Molecular Weight | 478.87 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | tert-butyl-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[(1E,3E,5E,7E,9E)-dodeca-1,3,5,7,9-pentaenoxy]propan-2-yl]oxy-dimethylsilane |
| SMILES | CC/C=C/C=C/C=C/C=C/C=C/OC[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O3Si2/c1-12-13-14-15-16-17-18-19-20-21-22-28-23-25(30-32(10,11)27(5,6)7)24-29-31(8,9)26(2,3)4/h13-22,25H,12,23-24H2,1-11H3/b14-13+,16-15+,18-17+,20-19+,22-21+/t25-/m1/s1 |
| InChIKey | NRIZCOPIOGTLNX-AQVNASIDSA-N |
| XLogP | 8.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.87 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|