C18H38O2Si3 — CID 44551713
dimethyl-[[(1E,3Z)-2-methyl-3-trimethylsilyloxypenta-1,3-dienoxy]methyl]-(3-trimethylsilylprop-1-en-2-yl)silane (PubChem CID 44551713) has the molecular formula C18H38O2Si3 and a molecular weight of 370.76 g/mol. Its IUPAC name is dimethyl-[[(1E,3Z)-2-methyl-3-trimethylsilyloxypenta-1,3-dienoxy]methyl]-(3-trimethylsilylprop-1-en-2-yl)silane.
| Compound Name | dimethyl-[[(1E,3Z)-2-methyl-3-trimethylsilyloxypenta-1,3-dienoxy]methyl]-(3-trimethylsilylprop-1-en-2-yl)silane |
|---|---|
| PubChem CID | 44551713 |
| Molecular Formula | C18H38O2Si3 |
| Molecular Weight | 370.76 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | dimethyl-[[(1E,3Z)-2-methyl-3-trimethylsilyloxypenta-1,3-dienoxy]methyl]-(3-trimethylsilylprop-1-en-2-yl)silane |
| SMILES | C=C(C[Si](C)(C)C)[Si](C)(C)CO/C=C(C)/C(=C/C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H38O2Si3/c1-12-18(20-22(7,8)9)16(2)13-19-15-23(10,11)17(3)14-21(4,5)6/h12-13H,3,14-15H2,1-2,4-11H3/b16-13+,18-12- |
| InChIKey | HSCQGRKAAMLOCS-JEIQTDJMSA-N |
| XLogP | 6.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.76 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|