C10H20O2Si — CID 58886814
[(1E)-1-methoxy-2-methylpenta-1,3-dien-3-yl]oxy-trimethylsilane (PubChem CID 58886814) has the molecular formula C10H20O2Si and a molecular weight of 200.35 g/mol. Its IUPAC name is [(1E)-1-methoxy-2-methylpenta-1,3-dien-3-yl]oxy-trimethylsilane.
| Compound Name | [(1E)-1-methoxy-2-methylpenta-1,3-dien-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 58886814 |
| Molecular Formula | C10H20O2Si |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | [(1E)-1-methoxy-2-methylpenta-1,3-dien-3-yl]oxy-trimethylsilane |
| SMILES | CC=C(O[Si](C)(C)C)/C(C)=C/OC |
| InChI | InChI=1S/C10H20O2Si/c1-7-10(9(2)8-11-3)12-13(4,5)6/h7-8H,1-6H3/b9-8+,10-7? |
| InChIKey | SSGAQVOLXCOJGN-DCZGXRLBSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|