C25H27N3O4S — CID 10096049
methyl 2-[(2R,3R,12bS)-3-acetyl-6-(1-oxidopyridin-1-ium-2-yl)sulfanyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]acetate (PubChem CID 10096049) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is methyl 2-[(2R,3R,12bS)-3-acetyl-6-(1-oxidopyridin-1-ium-2-yl)sulfanyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,12bS)-3-acetyl-6-(1-oxidopyridin-1-ium-2-yl)sulfanyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]acetate |
|---|---|
| PubChem CID | 10096049 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | methyl 2-[(2R,3R,12bS)-3-acetyl-6-(1-oxidopyridin-1-ium-2-yl)sulfanyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1C[C@H]2c3[nH]c4ccccc4c3CC(Sc3cccc[n+]3[O-])N2C[C@@H]1C(C)=O |
| InChI | InChI=1S/C25H27N3O4S/c1-15(29)19-14-27-21(11-16(19)12-24(30)32-2)25-18(17-7-3-4-8-20(17)26-25)13-23(27)33-22-9-5-6-10-28(22)31/h3-10,16,19,21,23,26H,11-14H2,1-2H3/t16-,19-,21+,23?/m1/s1 |
| InChIKey | LRLDVJLQKUKKMR-NLXPQBENSA-N |
| XLogP | 3.61 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|