C21H25N3O2 — CID 102278641
methyl 2-[(2R,3R,6S,12bS)-6-cyano-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]acetate (PubChem CID 102278641) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is methyl 2-[(2R,3R,6S,12bS)-6-cyano-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,6S,12bS)-6-cyano-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]acetate |
|---|---|
| PubChem CID | 102278641 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | methyl 2-[(2R,3R,6S,12bS)-6-cyano-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]acetate |
| SMILES | CC[C@H]1CN2[C@H](C#N)Cc3c([nH]c4ccccc34)[C@@H]2C[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C21H25N3O2/c1-3-13-12-24-15(11-22)10-17-16-6-4-5-7-18(16)23-21(17)19(24)8-14(13)9-20(25)26-2/h4-7,13-15,19,23H,3,8-10,12H2,1-2H3/t13-,14+,15-,19-/m0/s1 |
| InChIKey | NQIASUHEFFGDCU-YGTYGHESSA-N |
| XLogP | 3.57 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|