C21H26N2O4 — CID 56950085
methyl (2R,15S,16S,18R)-16-ethyl-2-methoxy-13-oxo-1,11-diazatetracyclo[13.2.1.04,12.05,10]octadeca-4(12),5,7,9-tetraene-18-carboxylate (PubChem CID 56950085) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is methyl (2R,15S,16S,18R)-16-ethyl-2-methoxy-13-oxo-1,11-diazatetracyclo[13.2.1.04,12.05,10]octadeca-4(12),5,7,9-tetraene-18-carboxylate.
| Compound Name | methyl (2R,15S,16S,18R)-16-ethyl-2-methoxy-13-oxo-1,11-diazatetracyclo[13.2.1.04,12.05,10]octadeca-4(12),5,7,9-tetraene-18-carboxylate |
|---|---|
| PubChem CID | 56950085 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | methyl (2R,15S,16S,18R)-16-ethyl-2-methoxy-13-oxo-1,11-diazatetracyclo[13.2.1.04,12.05,10]octadeca-4(12),5,7,9-tetraene-18-carboxylate |
| SMILES | CC[C@@H]1CN2[C@H](OC)Cc3c([nH]c4ccccc34)C(=O)C[C@@H]1[C@@H]2C(=O)OC |
| InChI | InChI=1S/C21H26N2O4/c1-4-12-11-23-18(26-2)10-15-13-7-5-6-8-16(13)22-19(15)17(24)9-14(12)20(23)21(25)27-3/h5-8,12,14,18,20,22H,4,9-11H2,1-3H3/t12-,14+,18-,20-/m1/s1 |
| InChIKey | WUEJOAVCVVQPME-AFAYAXFZSA-N |
| XLogP | 2.77 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|