C19H32N3O2+ — CID 100960888
methyl (1S,4R,10R)-10-heptyl-6-methyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodeca-5,8-diene-5-carboxylate (PubChem CID 100960888) has the molecular formula C19H32N3O2+ and a molecular weight of 334.48 g/mol. Its IUPAC name is methyl (1S,4R,10R)-10-heptyl-6-methyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodeca-5,8-diene-5-carboxylate.
| Compound Name | methyl (1S,4R,10R)-10-heptyl-6-methyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodeca-5,8-diene-5-carboxylate |
|---|---|
| PubChem CID | 100960888 |
| Molecular Formula | C19H32N3O2+ |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | methyl (1S,4R,10R)-10-heptyl-6-methyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodeca-5,8-diene-5-carboxylate |
| SMILES | CCCCCCC[C@@H]1C[C@@H]2CC[C@@H]3C(C(=O)OC)=C(C)NC(=N1)[NH+]23 |
| InChI | InChI=1S/C19H31N3O2/c1-4-5-6-7-8-9-14-12-15-10-11-16-17(18(23)24-3)13(2)20-19(21-14)22(15)16/h14-16H,4-12H2,1-3H3,(H,20,21)/p+1/t14-,15+,16-/m1/s1 |
| InChIKey | OTAWGCGJWAKOIF-OWCLPIDISA-O |
| XLogP | 1.94 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|